C29H30N6O — CID 134108209
2-N-(2,3-dihydro-1H-inden-2-yl)-4-N-(2,3-dihydro-1H-inden-5-yl)-6-N-[(3-methoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 134108209) has the molecular formula C29H30N6O and a molecular weight of 478.60 g/mol. Its IUPAC name is 2-N-(2,3-dihydro-1H-inden-2-yl)-4-N-(2,3-dihydro-1H-inden-5-yl)-6-N-[(3-methoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(2,3-dihydro-1H-inden-2-yl)-4-N-(2,3-dihydro-1H-inden-5-yl)-6-N-[(3-methoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 134108209 |
| Molecular Formula | C29H30N6O |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | 2-N-(2,3-dihydro-1H-inden-2-yl)-4-N-(2,3-dihydro-1H-inden-5-yl)-6-N-[(3-methoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1cccc(CNc2nc(Nc3ccc4c(c3)CCC4)nc(NC3Cc4ccccc4C3)n2)c1 |
| InChI | InChI=1S/C29H30N6O/c1-36-26-11-4-6-19(14-26)18-30-27-33-28(31-24-13-12-20-9-5-10-21(20)15-24)35-29(34-27)32-25-16-22-7-2-3-8-23(22)17-25/h2-4,6-8,11-15,25H,5,9-10,16-18H2,1H3,(H3,30,31,32,33,34,35) |
| InChIKey | GWFNHUAIRYQZQO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 83.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |