C10H21BNO4- — CID 134108879
2,4,4,9-tetramethyl-1,5,7,11-tetraoxa-6-boranuidaspiro[5.5]undecan-9-amine (PubChem CID 134108879) has the molecular formula C10H21BNO4- and a molecular weight of 230.09 g/mol. Its IUPAC name is 2,4,4,9-tetramethyl-1,5,7,11-tetraoxa-6-boranuidaspiro[5.5]undecan-9-amine.
| Compound Name | 2,4,4,9-tetramethyl-1,5,7,11-tetraoxa-6-boranuidaspiro[5.5]undecan-9-amine |
|---|---|
| PubChem CID | 134108879 |
| Molecular Formula | C10H21BNO4- |
| Molecular Weight | 230.09 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 2,4,4,9-tetramethyl-1,5,7,11-tetraoxa-6-boranuidaspiro[5.5]undecan-9-amine |
| SMILES | CC1CC(C)(C)O[B-]2(OCC(C)(N)CO2)O1 |
| InChI | InChI=1S/C10H21BNO4/c1-8-5-9(2,3)16-11(15-8)13-6-10(4,12)7-14-11/h8H,5-7,12H2,1-4H3/q-1 |
| InChIKey | AGNRQAQQQDVZGT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.09 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|