C17H13F3N4O4S2 — CID 134109213
3-(2,5-dimethoxy-4-nitrophenyl)sulfanyl-4-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-5-thione (PubChem CID 134109213) has the molecular formula C17H13F3N4O4S2 and a molecular weight of 458.44 g/mol. Its IUPAC name is 3-(2,5-dimethoxy-4-nitrophenyl)sulfanyl-4-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2,5-dimethoxy-4-nitrophenyl)sulfanyl-4-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 134109213 |
| Molecular Formula | C17H13F3N4O4S2 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | 3-(2,5-dimethoxy-4-nitrophenyl)sulfanyl-4-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cc([N+](=O)[O-])c(OC)cc1Sc1n[nH]c(=S)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H13F3N4O4S2/c1-27-12-8-14(13(28-2)7-11(12)24(25)26)30-16-22-21-15(29)23(16)10-5-3-4-9(6-10)17(18,19)20/h3-8H,1-2H3,(H,21,29) |
| InChIKey | AVZSTUMNRAKGIW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 95.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|