About 5-tert-butyl-2-(4-ethynyl-3-methylphenyl)-1,3-dithiane
5-tert-butyl-2-(4-ethynyl-3-methylphenyl)-1,3-dithiane (PubChem CID 134109533) has the molecular formula C17H22S2
and a molecular weight of 290.50 g/mol. Its IUPAC name is 5-tert-butyl-2-(4-ethynyl-3-methylphenyl)-1,3-dithiane.
Molecular Properties
| Compound Name | 5-tert-butyl-2-(4-ethynyl-3-methylphenyl)-1,3-dithiane |
| PubChem CID | 134109533 |
| Molecular Formula | C17H22S2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 5-tert-butyl-2-(4-ethynyl-3-methylphenyl)-1,3-dithiane |
| SMILES | C#Cc1ccc(C2SCC(C(C)(C)C)CS2)cc1C |
| InChI | InChI=1S/C17H22S2/c1-6-13-7-8-14(9-12(13)2)16-18-10-15(11-19-16)17(3,4)5/h1,7-9,15-16H,10-11H2,2-5H3 |
| InChIKey | SVFUVMYNIMVAHE-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-tert-butyl-2-(4-ethynyl-3-methylphenyl)-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-2-(4-ethynyl-3-methylphenyl)-1,3-dithiane?
The IUPAC name of 5-tert-butyl-2-(4-ethynyl-3-methylphenyl)-1,3-dithiane (CID 134109533) is 5-tert-butyl-2-(4-ethynyl-3-methylphenyl)-1,3-dithiane.
What is the SMILES notation for 5-tert-butyl-2-(4-ethynyl-3-methylphenyl)-1,3-dithiane?
The canonical SMILES for 5-tert-butyl-2-(4-ethynyl-3-methylphenyl)-1,3-dithiane is C#Cc1ccc(C2SCC(C(C)(C)C)CS2)cc1C.
What is the InChIKey of 5-tert-butyl-2-(4-ethynyl-3-methylphenyl)-1,3-dithiane?
The InChIKey is SVFUVMYNIMVAHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22S2/c1-6-13-7-8-14(9-12(13)2)16-18-10-15(11-19-16)17(3,4)5/h1,7-9,15-16H,10-11H2,2-5H3.
What are the key properties of 5-tert-butyl-2-(4-ethynyl-3-methylphenyl)-1,3-dithiane?
5-tert-butyl-2-(4-ethynyl-3-methylphenyl)-1,3-dithiane has a molecular weight of 290.50 g/mol, XLogP of 5.12, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-2-(4-ethynyl-3-methylphenyl)-1,3-dithiane is sourced from PubChem (CID 134109533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).