C10H7Cl2NO3 — CID 134109892
3-[[(Z)-2,3-dichloroprop-2-enoyl]amino]benzoic acid (PubChem CID 134109892) has the molecular formula C10H7Cl2NO3 and a molecular weight of 260.08 g/mol. Its IUPAC name is 3-[[(Z)-2,3-dichloroprop-2-enoyl]amino]benzoic acid.
| Compound Name | 3-[[(Z)-2,3-dichloroprop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 134109892 |
| Molecular Formula | C10H7Cl2NO3 |
| Molecular Weight | 260.08 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | 3-[[(Z)-2,3-dichloroprop-2-enoyl]amino]benzoic acid |
| SMILES | O=C(Nc1cccc(C(=O)O)c1)/C(Cl)=C/Cl |
| InChI | InChI=1S/C10H7Cl2NO3/c11-5-8(12)9(14)13-7-3-1-2-6(4-7)10(15)16/h1-5H,(H,13,14)(H,15,16)/b8-5- |
| InChIKey | GDKDBKFDYGZLHP-YVMONPNESA-N |
| XLogP | 2.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.08 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|