C26H33NO4 — CID 1341111
9-(3,4-dimethoxyphenyl)-3,3,6,6,10-pentamethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 1341111) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is 9-(3,4-dimethoxyphenyl)-3,3,6,6,10-pentamethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-(3,4-dimethoxyphenyl)-3,3,6,6,10-pentamethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 1341111 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 9-(3,4-dimethoxyphenyl)-3,3,6,6,10-pentamethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | COc1ccc(C2C3=C(CC(C)(C)CC3=O)N(C)C3=C2C(=O)CC(C)(C)C3)cc1OC |
| InChI | InChI=1S/C26H33NO4/c1-25(2)11-16-23(18(28)13-25)22(15-8-9-20(30-6)21(10-15)31-7)24-17(27(16)5)12-26(3,4)14-19(24)29/h8-10,22H,11-14H2,1-7H3 |
| InChIKey | XFNXJYJBMRBTFP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |