About 2-(6-phenoxy-1,3-benzoxazol-2-yl)benzoate;propan-2-ylazanium
2-(6-phenoxy-1,3-benzoxazol-2-yl)benzoate;propan-2-ylazanium (PubChem CID 134111175) has the molecular formula C23H22N2O4
and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-(6-phenoxy-1,3-benzoxazol-2-yl)benzoate;propan-2-ylazanium.
Molecular Properties
| Compound Name | 2-(6-phenoxy-1,3-benzoxazol-2-yl)benzoate;propan-2-ylazanium |
| PubChem CID | 134111175 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 2-(6-phenoxy-1,3-benzoxazol-2-yl)benzoate;propan-2-ylazanium |
| SMILES | CC(C)[NH3+].O=C([O-])c1ccccc1-c1nc2ccc(Oc3ccccc3)cc2o1 |
| InChI | InChI=1S/C20H13NO4.C3H9N/c22-20(23)16-9-5-4-8-15(16)19-21-17-11-10-14(12-18(17)25-19)24-13-6-2-1-3-7-13;1-3(2)4/h1-12H,(H,22,23);3H,4H2,1-2H3 |
| InChIKey | IFTLDSWCDUMPJS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 103.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(6-phenoxy-1,3-benzoxazol-2-yl)benzoate;propan-2-ylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-phenoxy-1,3-benzoxazol-2-yl)benzoate;propan-2-ylazanium?
The IUPAC name of 2-(6-phenoxy-1,3-benzoxazol-2-yl)benzoate;propan-2-ylazanium (CID 134111175) is 2-(6-phenoxy-1,3-benzoxazol-2-yl)benzoate;propan-2-ylazanium.
What is the SMILES notation for 2-(6-phenoxy-1,3-benzoxazol-2-yl)benzoate;propan-2-ylazanium?
The canonical SMILES for 2-(6-phenoxy-1,3-benzoxazol-2-yl)benzoate;propan-2-ylazanium is CC(C)[NH3+].O=C([O-])c1ccccc1-c1nc2ccc(Oc3ccccc3)cc2o1.
What is the InChIKey of 2-(6-phenoxy-1,3-benzoxazol-2-yl)benzoate;propan-2-ylazanium?
The InChIKey is IFTLDSWCDUMPJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13NO4.C3H9N/c22-20(23)16-9-5-4-8-15(16)19-21-17-11-10-14(12-18(17)25-19)24-13-6-2-1-3-7-13;1-3(2)4/h1-12H,(H,22,23);3H,4H2,1-2H3.
What are the key properties of 2-(6-phenoxy-1,3-benzoxazol-2-yl)benzoate;propan-2-ylazanium?
2-(6-phenoxy-1,3-benzoxazol-2-yl)benzoate;propan-2-ylazanium has a molecular weight of 390.44 g/mol, XLogP of 3.29, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-phenoxy-1,3-benzoxazol-2-yl)benzoate;propan-2-ylazanium is sourced from PubChem (CID 134111175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).