C18H29N5OS — CID 134111392
N-(3-acetylphenyl)-N'-[2-(2-aminoethylsulfanyl)ethyl]-4-methylpiperazine-1-carboximidamide (PubChem CID 134111392) has the molecular formula C18H29N5OS and a molecular weight of 363.53 g/mol. Its IUPAC name is N-(3-acetylphenyl)-N'-[2-(2-aminoethylsulfanyl)ethyl]-4-methylpiperazine-1-carboximidamide.
| Compound Name | N-(3-acetylphenyl)-N'-[2-(2-aminoethylsulfanyl)ethyl]-4-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 134111392 |
| Molecular Formula | C18H29N5OS |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | N-(3-acetylphenyl)-N'-[2-(2-aminoethylsulfanyl)ethyl]-4-methylpiperazine-1-carboximidamide |
| SMILES | CC(=O)c1cccc(N/C(=N/CCSCCN)N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C18H29N5OS/c1-15(24)16-4-3-5-17(14-16)21-18(20-7-13-25-12-6-19)23-10-8-22(2)9-11-23/h3-5,14H,6-13,19H2,1-2H3,(H,20,21) |
| InChIKey | REWWFJIJGHQCBE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|