About 2-[(4-bromophenyl)carbamoyl]-1,1-dioxo-4H-1λ6,4-benzothiazin-3-olate
2-[(4-bromophenyl)carbamoyl]-1,1-dioxo-4H-1λ6,4-benzothiazin-3-olate (PubChem CID 134112343) has the molecular formula C15H10BrN2O4S-
and a molecular weight of 394.23 g/mol. Its IUPAC name is 2-[(4-bromophenyl)carbamoyl]-1,1-dioxo-4H-1λ6,4-benzothiazin-3-olate.
Molecular Properties
| Compound Name | 2-[(4-bromophenyl)carbamoyl]-1,1-dioxo-4H-1λ6,4-benzothiazin-3-olate |
| PubChem CID | 134112343 |
| Molecular Formula | C15H10BrN2O4S- |
| Molecular Weight | 394.23 g/mol |
| Exact Mass | 392.96 |
| IUPAC Name | 2-[(4-bromophenyl)carbamoyl]-1,1-dioxo-4H-1λ6,4-benzothiazin-3-olate |
| SMILES | O=C(Nc1ccc(Br)cc1)C1=C([O-])Nc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C15H11BrN2O4S/c16-9-5-7-10(8-6-9)17-14(19)13-15(20)18-11-3-1-2-4-12(11)23(13,21)22/h1-8,18,20H,(H,17,19)/p-1 |
| InChIKey | PXEOGIYPISFODB-UHFFFAOYSA-M |
| XLogP | 1.82 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-bromophenyl)carbamoyl]-1,1-dioxo-4H-1λ6,4-benzothiazin-3-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-bromophenyl)carbamoyl]-1,1-dioxo-4H-1λ6,4-benzothiazin-3-olate?
The IUPAC name of 2-[(4-bromophenyl)carbamoyl]-1,1-dioxo-4H-1λ6,4-benzothiazin-3-olate (CID 134112343) is 2-[(4-bromophenyl)carbamoyl]-1,1-dioxo-4H-1λ6,4-benzothiazin-3-olate.
What is the SMILES notation for 2-[(4-bromophenyl)carbamoyl]-1,1-dioxo-4H-1λ6,4-benzothiazin-3-olate?
The canonical SMILES for 2-[(4-bromophenyl)carbamoyl]-1,1-dioxo-4H-1λ6,4-benzothiazin-3-olate is O=C(Nc1ccc(Br)cc1)C1=C([O-])Nc2ccccc2S1(=O)=O.
What is the InChIKey of 2-[(4-bromophenyl)carbamoyl]-1,1-dioxo-4H-1λ6,4-benzothiazin-3-olate?
The InChIKey is PXEOGIYPISFODB-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H11BrN2O4S/c16-9-5-7-10(8-6-9)17-14(19)13-15(20)18-11-3-1-2-4-12(11)23(13,21)22/h1-8,18,20H,(H,17,19)/p-1.
What are the key properties of 2-[(4-bromophenyl)carbamoyl]-1,1-dioxo-4H-1λ6,4-benzothiazin-3-olate?
2-[(4-bromophenyl)carbamoyl]-1,1-dioxo-4H-1λ6,4-benzothiazin-3-olate has a molecular weight of 394.23 g/mol, XLogP of 1.82, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-bromophenyl)carbamoyl]-1,1-dioxo-4H-1λ6,4-benzothiazin-3-olate is sourced from PubChem (CID 134112343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).