C18H17N3O4 — CID 134113602
3-methoxy-N-(3-oxo-4-prop-2-enylpyrido[3,2-b][1,4]oxazin-6-yl)benzamide (PubChem CID 134113602) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is 3-methoxy-N-(3-oxo-4-prop-2-enylpyrido[3,2-b][1,4]oxazin-6-yl)benzamide.
| Compound Name | 3-methoxy-N-(3-oxo-4-prop-2-enylpyrido[3,2-b][1,4]oxazin-6-yl)benzamide |
|---|---|
| PubChem CID | 134113602 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 3-methoxy-N-(3-oxo-4-prop-2-enylpyrido[3,2-b][1,4]oxazin-6-yl)benzamide |
| SMILES | C=CCN1C(=O)COc2ccc(NC(=O)c3cccc(OC)c3)nc21 |
| InChI | InChI=1S/C18H17N3O4/c1-3-9-21-16(22)11-25-14-7-8-15(19-17(14)21)20-18(23)12-5-4-6-13(10-12)24-2/h3-8,10H,1,9,11H2,2H3,(H,19,20,23) |
| InChIKey | DXSBKEVUWBCACV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|