About 4-methyl-2-phenyl-5-[5-(trichloromethyl)-1H-1,2,4-triazol-3-yl]triazole
4-methyl-2-phenyl-5-[5-(trichloromethyl)-1H-1,2,4-triazol-3-yl]triazole (PubChem CID 134113829) has the molecular formula C12H9Cl3N6
and a molecular weight of 343.61 g/mol. Its IUPAC name is 4-methyl-2-phenyl-5-[5-(trichloromethyl)-1H-1,2,4-triazol-3-yl]triazole.
Molecular Properties
| Compound Name | 4-methyl-2-phenyl-5-[5-(trichloromethyl)-1H-1,2,4-triazol-3-yl]triazole |
| PubChem CID | 134113829 |
| Molecular Formula | C12H9Cl3N6 |
| Molecular Weight | 343.61 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 4-methyl-2-phenyl-5-[5-(trichloromethyl)-1H-1,2,4-triazol-3-yl]triazole |
| SMILES | Cc1nn(-c2ccccc2)nc1-c1n[nH]c(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C12H9Cl3N6/c1-7-9(10-16-11(18-17-10)12(13,14)15)20-21(19-7)8-5-3-2-4-6-8/h2-6H,1H3,(H,16,17,18) |
| InChIKey | BKOFBKDFVSDVHS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.61 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2-phenyl-5-[5-(trichloromethyl)-1H-1,2,4-triazol-3-yl]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-phenyl-5-[5-(trichloromethyl)-1H-1,2,4-triazol-3-yl]triazole?
The IUPAC name of 4-methyl-2-phenyl-5-[5-(trichloromethyl)-1H-1,2,4-triazol-3-yl]triazole (CID 134113829) is 4-methyl-2-phenyl-5-[5-(trichloromethyl)-1H-1,2,4-triazol-3-yl]triazole.
What is the SMILES notation for 4-methyl-2-phenyl-5-[5-(trichloromethyl)-1H-1,2,4-triazol-3-yl]triazole?
The canonical SMILES for 4-methyl-2-phenyl-5-[5-(trichloromethyl)-1H-1,2,4-triazol-3-yl]triazole is Cc1nn(-c2ccccc2)nc1-c1n[nH]c(C(Cl)(Cl)Cl)n1.
What is the InChIKey of 4-methyl-2-phenyl-5-[5-(trichloromethyl)-1H-1,2,4-triazol-3-yl]triazole?
The InChIKey is BKOFBKDFVSDVHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Cl3N6/c1-7-9(10-16-11(18-17-10)12(13,14)15)20-21(19-7)8-5-3-2-4-6-8/h2-6H,1H3,(H,16,17,18).
What are the key properties of 4-methyl-2-phenyl-5-[5-(trichloromethyl)-1H-1,2,4-triazol-3-yl]triazole?
4-methyl-2-phenyl-5-[5-(trichloromethyl)-1H-1,2,4-triazol-3-yl]triazole has a molecular weight of 343.61 g/mol, XLogP of 3.19, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-phenyl-5-[5-(trichloromethyl)-1H-1,2,4-triazol-3-yl]triazole is sourced from PubChem (CID 134113829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).