C17H13FN4O2 — CID 134114693
(1E)-1-[(4-fluorophenyl)hydrazinylidene]-3,4-dihydro-[1,4]oxazino[3,4-b]quinazolin-6-one (PubChem CID 134114693) has the molecular formula C17H13FN4O2 and a molecular weight of 324.32 g/mol. Its IUPAC name is (1E)-1-[(4-fluorophenyl)hydrazinylidene]-3,4-dihydro-[1,4]oxazino[3,4-b]quinazolin-6-one.
| Compound Name | (1E)-1-[(4-fluorophenyl)hydrazinylidene]-3,4-dihydro-[1,4]oxazino[3,4-b]quinazolin-6-one |
|---|---|
| PubChem CID | 134114693 |
| Molecular Formula | C17H13FN4O2 |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | (1E)-1-[(4-fluorophenyl)hydrazinylidene]-3,4-dihydro-[1,4]oxazino[3,4-b]quinazolin-6-one |
| SMILES | O=c1c2ccccc2nc2n1CCO/C2=N/Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H13FN4O2/c18-11-5-7-12(8-6-11)20-21-16-15-19-14-4-2-1-3-13(14)17(23)22(15)9-10-24-16/h1-8,20H,9-10H2/b21-16+ |
| InChIKey | JHAJSBXJZBGMFJ-LTGZKZEYSA-N |
| XLogP | 2.34 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|