C13H13N3O2 — CID 134114768
2-(5-amino-2-pyridinyl)-4,5,6,7-tetrahydroisoindole-1,3-dione (PubChem CID 134114768) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is 2-(5-amino-2-pyridinyl)-4,5,6,7-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-(5-amino-2-pyridinyl)-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 134114768 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 2-(5-amino-2-pyridinyl)-4,5,6,7-tetrahydroisoindole-1,3-dione |
| SMILES | Nc1ccc(N2C(=O)C3=C(CCCC3)C2=O)nc1 |
| InChI | InChI=1S/C13H13N3O2/c14-8-5-6-11(15-7-8)16-12(17)9-3-1-2-4-10(9)13(16)18/h5-7H,1-4,14H2 |
| InChIKey | WQBQJXNPGSUDNO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|