About 3-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol
3-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol (PubChem CID 13411482) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is 3-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol.
Molecular Properties
| Compound Name | 3-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol |
| PubChem CID | 13411482 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 3-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol |
| SMILES | COC1=CCC(C(C)CCO)=CC1 |
| InChI | InChI=1S/C11H18O2/c1-9(7-8-12)10-3-5-11(13-2)6-4-10/h3,6,9,12H,4-5,7-8H2,1-2H3 |
| InChIKey | CFZGGRMDUMAPAR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol?
The IUPAC name of 3-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol (CID 13411482) is 3-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol.
What is the SMILES notation for 3-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol?
The canonical SMILES for 3-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol is COC1=CCC(C(C)CCO)=CC1.
What is the InChIKey of 3-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol?
The InChIKey is CFZGGRMDUMAPAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2/c1-9(7-8-12)10-3-5-11(13-2)6-4-10/h3,6,9,12H,4-5,7-8H2,1-2H3.
What are the key properties of 3-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol?
3-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol has a molecular weight of 182.26 g/mol, XLogP of 2.26, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol is sourced from PubChem (CID 13411482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).