C19H18N2O3 — CID 134115192
1,4,5,6-tetrahydropyrimidin-2-ylmethyl 9H-xanthene-9-carboxylate (PubChem CID 134115192) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is 1,4,5,6-tetrahydropyrimidin-2-ylmethyl 9H-xanthene-9-carboxylate.
| Compound Name | 1,4,5,6-tetrahydropyrimidin-2-ylmethyl 9H-xanthene-9-carboxylate |
|---|---|
| PubChem CID | 134115192 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 1,4,5,6-tetrahydropyrimidin-2-ylmethyl 9H-xanthene-9-carboxylate |
| SMILES | O=C(OCC1=NCCCN1)C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C19H18N2O3/c22-19(23-12-17-20-10-5-11-21-17)18-13-6-1-3-8-15(13)24-16-9-4-2-7-14(16)18/h1-4,6-9,18H,5,10-12H2,(H,20,21) |
| InChIKey | XMINLJNEPKNHAT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |