C11H13NO3 — CID 134115337
5,7-dihydroxy-1,2-dimethyl-2,3-dihydroquinolin-4-one (PubChem CID 134115337) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 5,7-dihydroxy-1,2-dimethyl-2,3-dihydroquinolin-4-one.
| Compound Name | 5,7-dihydroxy-1,2-dimethyl-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 134115337 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 5,7-dihydroxy-1,2-dimethyl-2,3-dihydroquinolin-4-one |
| SMILES | CC1CC(=O)c2c(O)cc(O)cc2N1C |
| InChI | InChI=1S/C11H13NO3/c1-6-3-9(14)11-8(12(6)2)4-7(13)5-10(11)15/h4-6,13,15H,3H2,1-2H3 |
| InChIKey | DBCFPXKOFBIJMB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |