C14H11Cl3O5 — CID 134115475
5-[1-hydroxy-2-(2,3,5-trichlorophenyl)ethylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 134115475) has the molecular formula C14H11Cl3O5 and a molecular weight of 365.60 g/mol. Its IUPAC name is 5-[1-hydroxy-2-(2,3,5-trichlorophenyl)ethylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[1-hydroxy-2-(2,3,5-trichlorophenyl)ethylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 134115475 |
| Molecular Formula | C14H11Cl3O5 |
| Molecular Weight | 365.60 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | 5-[1-hydroxy-2-(2,3,5-trichlorophenyl)ethylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=C(O)Cc2cc(Cl)cc(Cl)c2Cl)C(=O)O1 |
| InChI | InChI=1S/C14H11Cl3O5/c1-14(2)21-12(19)10(13(20)22-14)9(18)4-6-3-7(15)5-8(16)11(6)17/h3,5,18H,4H2,1-2H3 |
| InChIKey | POICQXHNARLKDO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.60 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|