C19H16Cl2N2O2S — CID 134115730
[3-(3-chlorobenzoyl)-4,4-dimethyl-2-sulfanylideneimidazolidin-1-yl]-(3-chlorophenyl)methanone (PubChem CID 134115730) has the molecular formula C19H16Cl2N2O2S and a molecular weight of 407.32 g/mol. Its IUPAC name is [3-(3-chlorobenzoyl)-4,4-dimethyl-2-sulfanylideneimidazolidin-1-yl]-(3-chlorophenyl)methanone.
| Compound Name | [3-(3-chlorobenzoyl)-4,4-dimethyl-2-sulfanylideneimidazolidin-1-yl]-(3-chlorophenyl)methanone |
|---|---|
| PubChem CID | 134115730 |
| Molecular Formula | C19H16Cl2N2O2S |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | [3-(3-chlorobenzoyl)-4,4-dimethyl-2-sulfanylideneimidazolidin-1-yl]-(3-chlorophenyl)methanone |
| SMILES | CC1(C)CN(C(=O)c2cccc(Cl)c2)C(=S)N1C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H16Cl2N2O2S/c1-19(2)11-22(16(24)12-5-3-7-14(20)9-12)18(26)23(19)17(25)13-6-4-8-15(21)10-13/h3-10H,11H2,1-2H3 |
| InChIKey | KSBCOLPSIYKVGQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|