C16H12FNO2 — CID 134115762
2-fluoro-N-(3-oxo-1,2-dihydroinden-2-yl)benzamide (PubChem CID 134115762) has the molecular formula C16H12FNO2 and a molecular weight of 269.27 g/mol. Its IUPAC name is 2-fluoro-N-(3-oxo-1,2-dihydroinden-2-yl)benzamide.
| Compound Name | 2-fluoro-N-(3-oxo-1,2-dihydroinden-2-yl)benzamide |
|---|---|
| PubChem CID | 134115762 |
| Molecular Formula | C16H12FNO2 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 2-fluoro-N-(3-oxo-1,2-dihydroinden-2-yl)benzamide |
| SMILES | O=C(NC1Cc2ccccc2C1=O)c1ccccc1F |
| InChI | InChI=1S/C16H12FNO2/c17-13-8-4-3-7-12(13)16(20)18-14-9-10-5-1-2-6-11(10)15(14)19/h1-8,14H,9H2,(H,18,20) |
| InChIKey | NXDZOLIOTGAQIM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |