C22H13Cl2F5N4O — CID 134116304
4,5-bis(4-chlorophenyl)-N'-(2,3,4,5,6-pentafluorophenyl)-3,4-dihydropyrazole-2-carbohydrazide (PubChem CID 134116304) has the molecular formula C22H13Cl2F5N4O and a molecular weight of 515.27 g/mol. Its IUPAC name is 4,5-bis(4-chlorophenyl)-N'-(2,3,4,5,6-pentafluorophenyl)-3,4-dihydropyrazole-2-carbohydrazide.
| Compound Name | 4,5-bis(4-chlorophenyl)-N'-(2,3,4,5,6-pentafluorophenyl)-3,4-dihydropyrazole-2-carbohydrazide |
|---|---|
| PubChem CID | 134116304 |
| Molecular Formula | C22H13Cl2F5N4O |
| Molecular Weight | 515.27 g/mol |
| Exact Mass | 514.04 |
| IUPAC Name | 4,5-bis(4-chlorophenyl)-N'-(2,3,4,5,6-pentafluorophenyl)-3,4-dihydropyrazole-2-carbohydrazide |
| SMILES | O=C(NNc1c(F)c(F)c(F)c(F)c1F)N1CC(c2ccc(Cl)cc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C22H13Cl2F5N4O/c23-12-5-1-10(2-6-12)14-9-33(32-20(14)11-3-7-13(24)8-4-11)22(34)31-30-21-18(28)16(26)15(25)17(27)19(21)29/h1-8,14,30H,9H2,(H,31,34) |
| InChIKey | ATDAWYKOVDKEOJ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.27 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|