C12H17N3O2 — CID 134116459
5-(4-amino-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)pentanoic acid (PubChem CID 134116459) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 5-(4-amino-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)pentanoic acid.
| Compound Name | 5-(4-amino-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 134116459 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 5-(4-amino-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)pentanoic acid |
| SMILES | Nc1nc(CCCCC(=O)O)nc2c1CCC2 |
| InChI | InChI=1S/C12H17N3O2/c13-12-8-4-3-5-9(8)14-10(15-12)6-1-2-7-11(16)17/h1-7H2,(H,16,17)(H2,13,14,15) |
| InChIKey | HXVOQLTXJAQYCD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|