About N-(4-fluorophenyl)-2,4-diphenylphthalazin-1-imine;hydrochloride
N-(4-fluorophenyl)-2,4-diphenylphthalazin-1-imine;hydrochloride (PubChem CID 134116657) has the molecular formula C26H19ClFN3
and a molecular weight of 427.91 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2,4-diphenylphthalazin-1-imine;hydrochloride.
Molecular Properties
| Compound Name | N-(4-fluorophenyl)-2,4-diphenylphthalazin-1-imine;hydrochloride |
| PubChem CID | 134116657 |
| Molecular Formula | C26H19ClFN3 |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | N-(4-fluorophenyl)-2,4-diphenylphthalazin-1-imine;hydrochloride |
| SMILES | Cl.Fc1ccc(/N=c2\c3ccccc3c(-c3ccccc3)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H18FN3.ClH/c27-20-15-17-21(18-16-20)28-26-24-14-8-7-13-23(24)25(19-9-3-1-4-10-19)29-30(26)22-11-5-2-6-12-22;/h1-18H;1H/b28-26+; |
| InChIKey | LFCLNUOZSWZFIE-GEHDOLFLSA-N |
| XLogP | 6.49 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-fluorophenyl)-2,4-diphenylphthalazin-1-imine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluorophenyl)-2,4-diphenylphthalazin-1-imine;hydrochloride?
The IUPAC name of N-(4-fluorophenyl)-2,4-diphenylphthalazin-1-imine;hydrochloride (CID 134116657) is N-(4-fluorophenyl)-2,4-diphenylphthalazin-1-imine;hydrochloride.
What is the SMILES notation for N-(4-fluorophenyl)-2,4-diphenylphthalazin-1-imine;hydrochloride?
The canonical SMILES for N-(4-fluorophenyl)-2,4-diphenylphthalazin-1-imine;hydrochloride is Cl.Fc1ccc(/N=c2\c3ccccc3c(-c3ccccc3)nn2-c2ccccc2)cc1.
What is the InChIKey of N-(4-fluorophenyl)-2,4-diphenylphthalazin-1-imine;hydrochloride?
The InChIKey is LFCLNUOZSWZFIE-GEHDOLFLSA-N. The full InChI is InChI=1S/C26H18FN3.ClH/c27-20-15-17-21(18-16-20)28-26-24-14-8-7-13-23(24)25(19-9-3-1-4-10-19)29-30(26)22-11-5-2-6-12-22;/h1-18H;1H/b28-26+;.
What are the key properties of N-(4-fluorophenyl)-2,4-diphenylphthalazin-1-imine;hydrochloride?
N-(4-fluorophenyl)-2,4-diphenylphthalazin-1-imine;hydrochloride has a molecular weight of 427.91 g/mol, XLogP of 6.49, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluorophenyl)-2,4-diphenylphthalazin-1-imine;hydrochloride is sourced from PubChem (CID 134116657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).