(5,5-dimethylcyclohexen-1-yl) trifluoromethanesulfonate

C9H13F3O3S — CID 13411667

IUPAC(5,5-dimethylcyclohexen-1-yl) trifluoromethanesulfonate
SMILESCC1(C)CCC=C(OS(=O)(=O)C(F)(F)F)C1
InChIInChI=1S/C9H13F3O3S/c1-8(2)5-3-4-7(6-8)15-16(13,14)9(10,11)12/h4H,3,5-6H2,1-2H3
InChIKeyZAPONKJBJLIMJT-UHFFFAOYSA-N
MW258.26 g/mol
LogP2.95
Rot. Bonds2

About (5,5-dimethylcyclohexen-1-yl) trifluoromethanesulfonate

(5,5-dimethylcyclohexen-1-yl) trifluoromethanesulfonate (PubChem CID 13411667) has the molecular formula C9H13F3O3S and a molecular weight of 258.26 g/mol. Its IUPAC name is (5,5-dimethylcyclohexen-1-yl) trifluoromethanesulfonate.

Molecular Properties

Compound Name(5,5-dimethylcyclohexen-1-yl) trifluoromethanesulfonate
PubChem CID13411667
Molecular FormulaC9H13F3O3S
Molecular Weight258.26 g/mol
Exact Mass258.05
IUPAC Name(5,5-dimethylcyclohexen-1-yl) trifluoromethanesulfonate
SMILESCC1(C)CCC=C(OS(=O)(=O)C(F)(F)F)C1
InChIInChI=1S/C9H13F3O3S/c1-8(2)5-3-4-7(6-8)15-16(13,14)9(10,11)12/h4H,3,5-6H2,1-2H3
InChIKeyZAPONKJBJLIMJT-UHFFFAOYSA-N
XLogP2.95
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.26
LogP ≤ 52.95
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}

Analyze (5,5-dimethylcyclohexen-1-yl) trifluoromethanesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5,5-dimethylcyclohexen-1-yl) trifluoromethanesulfonate?
The IUPAC name of (5,5-dimethylcyclohexen-1-yl) trifluoromethanesulfonate (CID 13411667) is (5,5-dimethylcyclohexen-1-yl) trifluoromethanesulfonate.
What is the SMILES notation for (5,5-dimethylcyclohexen-1-yl) trifluoromethanesulfonate?
The canonical SMILES for (5,5-dimethylcyclohexen-1-yl) trifluoromethanesulfonate is CC1(C)CCC=C(OS(=O)(=O)C(F)(F)F)C1.
What is the InChIKey of (5,5-dimethylcyclohexen-1-yl) trifluoromethanesulfonate?
The InChIKey is ZAPONKJBJLIMJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3O3S/c1-8(2)5-3-4-7(6-8)15-16(13,14)9(10,11)12/h4H,3,5-6H2,1-2H3.
What are the key properties of (5,5-dimethylcyclohexen-1-yl) trifluoromethanesulfonate?
(5,5-dimethylcyclohexen-1-yl) trifluoromethanesulfonate has a molecular weight of 258.26 g/mol, XLogP of 2.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5,5-dimethylcyclohexen-1-yl) trifluoromethanesulfonate is sourced from PubChem (CID 13411667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).