About 2-(3-chlorophenyl)-1,3-dioxo-N-propyl-4H-isoquinoline-4-carboxamide
2-(3-chlorophenyl)-1,3-dioxo-N-propyl-4H-isoquinoline-4-carboxamide (PubChem CID 134117207) has the molecular formula C19H17ClN2O3
and a molecular weight of 356.81 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1,3-dioxo-N-propyl-4H-isoquinoline-4-carboxamide.
Molecular Properties
| Compound Name | 2-(3-chlorophenyl)-1,3-dioxo-N-propyl-4H-isoquinoline-4-carboxamide |
| PubChem CID | 134117207 |
| Molecular Formula | C19H17ClN2O3 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 2-(3-chlorophenyl)-1,3-dioxo-N-propyl-4H-isoquinoline-4-carboxamide |
| SMILES | CCCNC(=O)C1C(=O)N(c2cccc(Cl)c2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C19H17ClN2O3/c1-2-10-21-17(23)16-14-8-3-4-9-15(14)18(24)22(19(16)25)13-7-5-6-12(20)11-13/h3-9,11,16H,2,10H2,1H3,(H,21,23) |
| InChIKey | YDFQQGYTOQFIEL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-chlorophenyl)-1,3-dioxo-N-propyl-4H-isoquinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenyl)-1,3-dioxo-N-propyl-4H-isoquinoline-4-carboxamide?
The IUPAC name of 2-(3-chlorophenyl)-1,3-dioxo-N-propyl-4H-isoquinoline-4-carboxamide (CID 134117207) is 2-(3-chlorophenyl)-1,3-dioxo-N-propyl-4H-isoquinoline-4-carboxamide.
What is the SMILES notation for 2-(3-chlorophenyl)-1,3-dioxo-N-propyl-4H-isoquinoline-4-carboxamide?
The canonical SMILES for 2-(3-chlorophenyl)-1,3-dioxo-N-propyl-4H-isoquinoline-4-carboxamide is CCCNC(=O)C1C(=O)N(c2cccc(Cl)c2)C(=O)c2ccccc21.
What is the InChIKey of 2-(3-chlorophenyl)-1,3-dioxo-N-propyl-4H-isoquinoline-4-carboxamide?
The InChIKey is YDFQQGYTOQFIEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17ClN2O3/c1-2-10-21-17(23)16-14-8-3-4-9-15(14)18(24)22(19(16)25)13-7-5-6-12(20)11-13/h3-9,11,16H,2,10H2,1H3,(H,21,23).
What are the key properties of 2-(3-chlorophenyl)-1,3-dioxo-N-propyl-4H-isoquinoline-4-carboxamide?
2-(3-chlorophenyl)-1,3-dioxo-N-propyl-4H-isoquinoline-4-carboxamide has a molecular weight of 356.81 g/mol, XLogP of 3.14, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenyl)-1,3-dioxo-N-propyl-4H-isoquinoline-4-carboxamide is sourced from PubChem (CID 134117207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).