C8H12N2O2S — CID 134117763
3,3,6-trimethyl-1,7a-dihydroimidazo[1,5-c][1,3]thiazole-5,7-dione (PubChem CID 134117763) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is 3,3,6-trimethyl-1,7a-dihydroimidazo[1,5-c][1,3]thiazole-5,7-dione.
| Compound Name | 3,3,6-trimethyl-1,7a-dihydroimidazo[1,5-c][1,3]thiazole-5,7-dione |
|---|---|
| PubChem CID | 134117763 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 3,3,6-trimethyl-1,7a-dihydroimidazo[1,5-c][1,3]thiazole-5,7-dione |
| SMILES | CN1C(=O)C2CSC(C)(C)N2C1=O |
| InChI | InChI=1S/C8H12N2O2S/c1-8(2)10-5(4-13-8)6(11)9(3)7(10)12/h5H,4H2,1-3H3 |
| InChIKey | OSGIHRUXLODQAJ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|