About N'-(3-butan-2-yl-4-cyano-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl chloride
N'-(3-butan-2-yl-4-cyano-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl chloride (PubChem CID 134118538) has the molecular formula C11H15ClN4S
and a molecular weight of 270.79 g/mol. Its IUPAC name is N'-(3-butan-2-yl-4-cyano-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl chloride.
Molecular Properties
| Compound Name | N'-(3-butan-2-yl-4-cyano-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl chloride |
| PubChem CID | 134118538 |
| Molecular Formula | C11H15ClN4S |
| Molecular Weight | 270.79 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | N'-(3-butan-2-yl-4-cyano-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl chloride |
| SMILES | CCC(C)c1nsc(/N=C(\Cl)N(C)C)c1C#N |
| InChI | InChI=1S/C11H15ClN4S/c1-5-7(2)9-8(6-13)10(17-15-9)14-11(12)16(3)4/h7H,5H2,1-4H3/b14-11+ |
| InChIKey | YFJDVTKSFPZBJV-SDNWHVSQSA-N |
| XLogP | 3.32 |
| TPSA | 52.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.79 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N'-(3-butan-2-yl-4-cyano-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-butan-2-yl-4-cyano-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl chloride?
The IUPAC name of N'-(3-butan-2-yl-4-cyano-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl chloride (CID 134118538) is N'-(3-butan-2-yl-4-cyano-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl chloride.
What is the SMILES notation for N'-(3-butan-2-yl-4-cyano-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl chloride?
The canonical SMILES for N'-(3-butan-2-yl-4-cyano-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl chloride is CCC(C)c1nsc(/N=C(\Cl)N(C)C)c1C#N.
What is the InChIKey of N'-(3-butan-2-yl-4-cyano-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl chloride?
The InChIKey is YFJDVTKSFPZBJV-SDNWHVSQSA-N. The full InChI is InChI=1S/C11H15ClN4S/c1-5-7(2)9-8(6-13)10(17-15-9)14-11(12)16(3)4/h7H,5H2,1-4H3/b14-11+.
What are the key properties of N'-(3-butan-2-yl-4-cyano-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl chloride?
N'-(3-butan-2-yl-4-cyano-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl chloride has a molecular weight of 270.79 g/mol, XLogP of 3.32, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-butan-2-yl-4-cyano-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl chloride is sourced from PubChem (CID 134118538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).