About 3-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-1,1-bis(prop-2-enyl)urea
3-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-1,1-bis(prop-2-enyl)urea (PubChem CID 134119303) has the molecular formula C14H18N4OS
and a molecular weight of 290.39 g/mol. Its IUPAC name is 3-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-1,1-bis(prop-2-enyl)urea.
Molecular Properties
| Compound Name | 3-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-1,1-bis(prop-2-enyl)urea |
| PubChem CID | 134119303 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 3-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-1,1-bis(prop-2-enyl)urea |
| SMILES | C=CCN(CC=C)C(=O)Nc1snc(C(C)C)c1C#N |
| InChI | InChI=1S/C14H18N4OS/c1-5-7-18(8-6-2)14(19)16-13-11(9-15)12(10(3)4)17-20-13/h5-6,10H,1-2,7-8H2,3-4H3,(H,16,19) |
| InChIKey | DXAUTEMFODEBRT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-1,1-bis(prop-2-enyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-1,1-bis(prop-2-enyl)urea?
The IUPAC name of 3-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-1,1-bis(prop-2-enyl)urea (CID 134119303) is 3-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-1,1-bis(prop-2-enyl)urea.
What is the SMILES notation for 3-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-1,1-bis(prop-2-enyl)urea?
The canonical SMILES for 3-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-1,1-bis(prop-2-enyl)urea is C=CCN(CC=C)C(=O)Nc1snc(C(C)C)c1C#N.
What is the InChIKey of 3-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-1,1-bis(prop-2-enyl)urea?
The InChIKey is DXAUTEMFODEBRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4OS/c1-5-7-18(8-6-2)14(19)16-13-11(9-15)12(10(3)4)17-20-13/h5-6,10H,1-2,7-8H2,3-4H3,(H,16,19).
What are the key properties of 3-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-1,1-bis(prop-2-enyl)urea?
3-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-1,1-bis(prop-2-enyl)urea has a molecular weight of 290.39 g/mol, XLogP of 3.34, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-1,1-bis(prop-2-enyl)urea is sourced from PubChem (CID 134119303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).