About (6-chloro-1,3-benzodioxol-5-yl)methyl 2,2-dichloro-3-(2-chlorophenyl)cyclopropane-1-carboxylate
(6-chloro-1,3-benzodioxol-5-yl)methyl 2,2-dichloro-3-(2-chlorophenyl)cyclopropane-1-carboxylate (PubChem CID 134119333) has the molecular formula C18H12Cl4O4
and a molecular weight of 434.10 g/mol. Its IUPAC name is (6-chloro-1,3-benzodioxol-5-yl)methyl 2,2-dichloro-3-(2-chlorophenyl)cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | (6-chloro-1,3-benzodioxol-5-yl)methyl 2,2-dichloro-3-(2-chlorophenyl)cyclopropane-1-carboxylate |
| PubChem CID | 134119333 |
| Molecular Formula | C18H12Cl4O4 |
| Molecular Weight | 434.10 g/mol |
| Exact Mass | 431.95 |
| IUPAC Name | (6-chloro-1,3-benzodioxol-5-yl)methyl 2,2-dichloro-3-(2-chlorophenyl)cyclopropane-1-carboxylate |
| SMILES | O=C(OCc1cc2c(cc1Cl)OCO2)C1C(c2ccccc2Cl)C1(Cl)Cl |
| InChI | InChI=1S/C18H12Cl4O4/c19-11-4-2-1-3-10(11)15-16(18(15,21)22)17(23)24-7-9-5-13-14(6-12(9)20)26-8-25-13/h1-6,15-16H,7-8H2 |
| InChIKey | OBGWUGOPHMIQDX-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.10 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (6-chloro-1,3-benzodioxol-5-yl)methyl 2,2-dichloro-3-(2-chlorophenyl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-1,3-benzodioxol-5-yl)methyl 2,2-dichloro-3-(2-chlorophenyl)cyclopropane-1-carboxylate?
The IUPAC name of (6-chloro-1,3-benzodioxol-5-yl)methyl 2,2-dichloro-3-(2-chlorophenyl)cyclopropane-1-carboxylate (CID 134119333) is (6-chloro-1,3-benzodioxol-5-yl)methyl 2,2-dichloro-3-(2-chlorophenyl)cyclopropane-1-carboxylate.
What is the SMILES notation for (6-chloro-1,3-benzodioxol-5-yl)methyl 2,2-dichloro-3-(2-chlorophenyl)cyclopropane-1-carboxylate?
The canonical SMILES for (6-chloro-1,3-benzodioxol-5-yl)methyl 2,2-dichloro-3-(2-chlorophenyl)cyclopropane-1-carboxylate is O=C(OCc1cc2c(cc1Cl)OCO2)C1C(c2ccccc2Cl)C1(Cl)Cl.
What is the InChIKey of (6-chloro-1,3-benzodioxol-5-yl)methyl 2,2-dichloro-3-(2-chlorophenyl)cyclopropane-1-carboxylate?
The InChIKey is OBGWUGOPHMIQDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12Cl4O4/c19-11-4-2-1-3-10(11)15-16(18(15,21)22)17(23)24-7-9-5-13-14(6-12(9)20)26-8-25-13/h1-6,15-16H,7-8H2.
What are the key properties of (6-chloro-1,3-benzodioxol-5-yl)methyl 2,2-dichloro-3-(2-chlorophenyl)cyclopropane-1-carboxylate?
(6-chloro-1,3-benzodioxol-5-yl)methyl 2,2-dichloro-3-(2-chlorophenyl)cyclopropane-1-carboxylate has a molecular weight of 434.10 g/mol, XLogP of 5.35, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-1,3-benzodioxol-5-yl)methyl 2,2-dichloro-3-(2-chlorophenyl)cyclopropane-1-carboxylate is sourced from PubChem (CID 134119333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).