C23H27NO4 — CID 134119488
5-oxo-5-[4-(2,3,4,5,6-pentamethylbenzoyl)anilino]pentanoic acid (PubChem CID 134119488) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is 5-oxo-5-[4-(2,3,4,5,6-pentamethylbenzoyl)anilino]pentanoic acid.
| Compound Name | 5-oxo-5-[4-(2,3,4,5,6-pentamethylbenzoyl)anilino]pentanoic acid |
|---|---|
| PubChem CID | 134119488 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 5-oxo-5-[4-(2,3,4,5,6-pentamethylbenzoyl)anilino]pentanoic acid |
| SMILES | Cc1c(C)c(C)c(C(=O)c2ccc(NC(=O)CCCC(=O)O)cc2)c(C)c1C |
| InChI | InChI=1S/C23H27NO4/c1-13-14(2)16(4)22(17(5)15(13)3)23(28)18-9-11-19(12-10-18)24-20(25)7-6-8-21(26)27/h9-12H,6-8H2,1-5H3,(H,24,25)(H,26,27) |
| InChIKey | DJJIWNBCYBPOJT-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |