About 3-chloro-5-(2,6-dichloro-4-fluorophenoxy)-1,2,6-thiadiazin-4-one
3-chloro-5-(2,6-dichloro-4-fluorophenoxy)-1,2,6-thiadiazin-4-one (PubChem CID 134119632) has the molecular formula C9H2Cl3FN2O2S
and a molecular weight of 327.55 g/mol. Its IUPAC name is 3-chloro-5-(2,6-dichloro-4-fluorophenoxy)-1,2,6-thiadiazin-4-one.
Molecular Properties
| Compound Name | 3-chloro-5-(2,6-dichloro-4-fluorophenoxy)-1,2,6-thiadiazin-4-one |
| PubChem CID | 134119632 |
| Molecular Formula | C9H2Cl3FN2O2S |
| Molecular Weight | 327.55 g/mol |
| Exact Mass | 325.89 |
| IUPAC Name | 3-chloro-5-(2,6-dichloro-4-fluorophenoxy)-1,2,6-thiadiazin-4-one |
| SMILES | O=c1c(Cl)nsnc1Oc1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C9H2Cl3FN2O2S/c10-4-1-3(13)2-5(11)7(4)17-9-6(16)8(12)14-18-15-9/h1-2H |
| InChIKey | DWVUAOLBCUKVOI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-chloro-5-(2,6-dichloro-4-fluorophenoxy)-1,2,6-thiadiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-(2,6-dichloro-4-fluorophenoxy)-1,2,6-thiadiazin-4-one?
The IUPAC name of 3-chloro-5-(2,6-dichloro-4-fluorophenoxy)-1,2,6-thiadiazin-4-one (CID 134119632) is 3-chloro-5-(2,6-dichloro-4-fluorophenoxy)-1,2,6-thiadiazin-4-one.
What is the SMILES notation for 3-chloro-5-(2,6-dichloro-4-fluorophenoxy)-1,2,6-thiadiazin-4-one?
The canonical SMILES for 3-chloro-5-(2,6-dichloro-4-fluorophenoxy)-1,2,6-thiadiazin-4-one is O=c1c(Cl)nsnc1Oc1c(Cl)cc(F)cc1Cl.
What is the InChIKey of 3-chloro-5-(2,6-dichloro-4-fluorophenoxy)-1,2,6-thiadiazin-4-one?
The InChIKey is DWVUAOLBCUKVOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H2Cl3FN2O2S/c10-4-1-3(13)2-5(11)7(4)17-9-6(16)8(12)14-18-15-9/h1-2H.
What are the key properties of 3-chloro-5-(2,6-dichloro-4-fluorophenoxy)-1,2,6-thiadiazin-4-one?
3-chloro-5-(2,6-dichloro-4-fluorophenoxy)-1,2,6-thiadiazin-4-one has a molecular weight of 327.55 g/mol, XLogP of 3.79, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-(2,6-dichloro-4-fluorophenoxy)-1,2,6-thiadiazin-4-one is sourced from PubChem (CID 134119632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).