C14H9Cl2O3S- — CID 134119880
(Z)-2-(3,5-dichlorophenyl)sulfonyl-1-phenylethenolate (PubChem CID 134119880) has the molecular formula C14H9Cl2O3S- and a molecular weight of 328.20 g/mol. Its IUPAC name is (Z)-2-(3,5-dichlorophenyl)sulfonyl-1-phenylethenolate.
| Compound Name | (Z)-2-(3,5-dichlorophenyl)sulfonyl-1-phenylethenolate |
|---|---|
| PubChem CID | 134119880 |
| Molecular Formula | C14H9Cl2O3S- |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | (Z)-2-(3,5-dichlorophenyl)sulfonyl-1-phenylethenolate |
| SMILES | O=S(=O)(/C=C(\[O-])c1ccccc1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H10Cl2O3S/c15-11-6-12(16)8-13(7-11)20(18,19)9-14(17)10-4-2-1-3-5-10/h1-9,17H/p-1/b14-9- |
| InChIKey | SFUGRDFXKKCSOS-ZROIWOOFSA-M |
| XLogP | 3.13 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|