C12H7N3O7 — CID 134120284
2-[(3,5-dinitro-2-pyridinyl)oxy]benzoic acid (PubChem CID 134120284) has the molecular formula C12H7N3O7 and a molecular weight of 305.20 g/mol. Its IUPAC name is 2-[(3,5-dinitro-2-pyridinyl)oxy]benzoic acid.
| Compound Name | 2-[(3,5-dinitro-2-pyridinyl)oxy]benzoic acid |
|---|---|
| PubChem CID | 134120284 |
| Molecular Formula | C12H7N3O7 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 2-[(3,5-dinitro-2-pyridinyl)oxy]benzoic acid |
| SMILES | O=C(O)c1ccccc1Oc1ncc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H7N3O7/c16-12(17)8-3-1-2-4-10(8)22-11-9(15(20)21)5-7(6-13-11)14(18)19/h1-6H,(H,16,17) |
| InChIKey | ILGWXENZYQYLEQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 145.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|