C15H15N3 — CID 134120564
1,3,6-trimethyl-4-phenylpyrazolo[3,4-b]pyridine (PubChem CID 134120564) has the molecular formula C15H15N3 and a molecular weight of 237.31 g/mol. Its IUPAC name is 1,3,6-trimethyl-4-phenylpyrazolo[3,4-b]pyridine.
| Compound Name | 1,3,6-trimethyl-4-phenylpyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 134120564 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 1,3,6-trimethyl-4-phenylpyrazolo[3,4-b]pyridine |
| SMILES | Cc1cc(-c2ccccc2)c2c(C)nn(C)c2n1 |
| InChI | InChI=1S/C15H15N3/c1-10-9-13(12-7-5-4-6-8-12)14-11(2)17-18(3)15(14)16-10/h4-9H,1-3H3 |
| InChIKey | BXEKPRDCEBPUSJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |