About 1H-[1]benzothiolo[3,2-g]indole
1H-[1]benzothiolo[3,2-g]indole (PubChem CID 13412151) has the molecular formula C14H9NS
and a molecular weight of 223.30 g/mol. Its IUPAC name is 1H-[1]benzothiolo[3,2-g]indole.
Molecular Properties
| Compound Name | 1H-[1]benzothiolo[3,2-g]indole |
| PubChem CID | 13412151 |
| Molecular Formula | C14H9NS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 1H-[1]benzothiolo[3,2-g]indole |
| SMILES | c1ccc2c(c1)sc1c2ccc2cc[nH]c21 |
| InChI | InChI=1S/C14H9NS/c1-2-4-12-10(3-1)11-6-5-9-7-8-15-13(9)14(11)16-12/h1-8,15H |
| InChIKey | GFSPWCQQEQOOPH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-[1]benzothiolo[3,2-g]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-[1]benzothiolo[3,2-g]indole?
The IUPAC name of 1H-[1]benzothiolo[3,2-g]indole (CID 13412151) is 1H-[1]benzothiolo[3,2-g]indole.
What is the SMILES notation for 1H-[1]benzothiolo[3,2-g]indole?
The canonical SMILES for 1H-[1]benzothiolo[3,2-g]indole is c1ccc2c(c1)sc1c2ccc2cc[nH]c21.
What is the InChIKey of 1H-[1]benzothiolo[3,2-g]indole?
The InChIKey is GFSPWCQQEQOOPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NS/c1-2-4-12-10(3-1)11-6-5-9-7-8-15-13(9)14(11)16-12/h1-8,15H.
What are the key properties of 1H-[1]benzothiolo[3,2-g]indole?
1H-[1]benzothiolo[3,2-g]indole has a molecular weight of 223.30 g/mol, XLogP of 4.54, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-[1]benzothiolo[3,2-g]indole is sourced from PubChem (CID 13412151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).