C14H24N2O6 — CID 134121617
ethyl (3Z)-3-[(Z)-(1,3-diethoxy-3-oxopropylidene)hydrazinylidene]-3-ethoxypropanoate (PubChem CID 134121617) has the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. Its IUPAC name is ethyl (3Z)-3-[(Z)-(1,3-diethoxy-3-oxopropylidene)hydrazinylidene]-3-ethoxypropanoate.
| Compound Name | ethyl (3Z)-3-[(Z)-(1,3-diethoxy-3-oxopropylidene)hydrazinylidene]-3-ethoxypropanoate |
|---|---|
| PubChem CID | 134121617 |
| Molecular Formula | C14H24N2O6 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | ethyl (3Z)-3-[(Z)-(1,3-diethoxy-3-oxopropylidene)hydrazinylidene]-3-ethoxypropanoate |
| SMILES | CCOC(=O)C/C(=N/N=C(/CC(=O)OCC)OCC)OCC |
| InChI | InChI=1S/C14H24N2O6/c1-5-19-11(9-13(17)21-7-3)15-16-12(20-6-2)10-14(18)22-8-4/h5-10H2,1-4H3/b15-11-,16-12- |
| InChIKey | PULNHPJYEVMRFW-NFLUSIDLSA-N |
| XLogP | 1.68 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|