C16H15F2NO3 — CID 134121636
6-(2,6-difluorophenyl)-2,4-dimethyl-7-oxo-6-azabicyclo[3.2.1]oct-3-ene-8-carboxylic acid (PubChem CID 134121636) has the molecular formula C16H15F2NO3 and a molecular weight of 307.30 g/mol. Its IUPAC name is 6-(2,6-difluorophenyl)-2,4-dimethyl-7-oxo-6-azabicyclo[3.2.1]oct-3-ene-8-carboxylic acid.
| Compound Name | 6-(2,6-difluorophenyl)-2,4-dimethyl-7-oxo-6-azabicyclo[3.2.1]oct-3-ene-8-carboxylic acid |
|---|---|
| PubChem CID | 134121636 |
| Molecular Formula | C16H15F2NO3 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 6-(2,6-difluorophenyl)-2,4-dimethyl-7-oxo-6-azabicyclo[3.2.1]oct-3-ene-8-carboxylic acid |
| SMILES | CC1=CC(C)C2C(=O)N(c3c(F)cccc3F)C1C2C(=O)O |
| InChI | InChI=1S/C16H15F2NO3/c1-7-6-8(2)13-12(16(21)22)11(7)15(20)19(13)14-9(17)4-3-5-10(14)18/h3-7,11-13H,1-2H3,(H,21,22) |
| InChIKey | GWHYQCHVNJAKFJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|