C27H42N4O — CID 134121819
N-(3-acetylphenyl)-N'-[4-[(4-aminocyclohexyl)methyl]cyclohexyl]piperidine-1-carboximidamide (PubChem CID 134121819) has the molecular formula C27H42N4O and a molecular weight of 438.66 g/mol. Its IUPAC name is N-(3-acetylphenyl)-N'-[4-[(4-aminocyclohexyl)methyl]cyclohexyl]piperidine-1-carboximidamide.
| Compound Name | N-(3-acetylphenyl)-N'-[4-[(4-aminocyclohexyl)methyl]cyclohexyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 134121819 |
| Molecular Formula | C27H42N4O |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.34 |
| IUPAC Name | N-(3-acetylphenyl)-N'-[4-[(4-aminocyclohexyl)methyl]cyclohexyl]piperidine-1-carboximidamide |
| SMILES | CC(=O)c1cccc(N/C(=N/C2CCC(CC3CCC(N)CC3)CC2)N2CCCCC2)c1 |
| InChI | InChI=1S/C27H42N4O/c1-20(32)23-6-5-7-26(19-23)30-27(31-16-3-2-4-17-31)29-25-14-10-22(11-15-25)18-21-8-12-24(28)13-9-21/h5-7,19,21-22,24-25H,2-4,8-18,28H2,1H3,(H,29,30) |
| InChIKey | CQTSWIWAQDWMCQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|