C19H14Cl4O2 — CID 134122073
11,12,13,14-tetrachloro-17,17-dimethoxypentacyclo[7.6.1.111,14.05,16.010,15]heptadeca-1,3,5(16),6,8,12-hexaene (PubChem CID 134122073) has the molecular formula C19H14Cl4O2 and a molecular weight of 416.13 g/mol. Its IUPAC name is 11,12,13,14-tetrachloro-17,17-dimethoxypentacyclo[7.6.1.111,14.05,16.010,15]heptadeca-1,3,5(16),6,8,12-hexaene.
| Compound Name | 11,12,13,14-tetrachloro-17,17-dimethoxypentacyclo[7.6.1.111,14.05,16.010,15]heptadeca-1,3,5(16),6,8,12-hexaene |
|---|---|
| PubChem CID | 134122073 |
| Molecular Formula | C19H14Cl4O2 |
| Molecular Weight | 416.13 g/mol |
| Exact Mass | 413.97 |
| IUPAC Name | 11,12,13,14-tetrachloro-17,17-dimethoxypentacyclo[7.6.1.111,14.05,16.010,15]heptadeca-1,3,5(16),6,8,12-hexaene |
| SMILES | COC1(OC)C2(Cl)C(Cl)=C(Cl)C1(Cl)C1c3cccc4cccc(c34)C12 |
| InChI | InChI=1S/C19H14Cl4O2/c1-24-19(25-2)17(22)13-10-7-3-5-9-6-4-8-11(12(9)10)14(13)18(19,23)16(21)15(17)20/h3-8,13-14H,1-2H3 |
| InChIKey | UYXMAEADRLKSNL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.13 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|