About 3-ethyl-2-(2-phenylsulfanylethyl)spiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one
3-ethyl-2-(2-phenylsulfanylethyl)spiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one (PubChem CID 134122164) has the molecular formula C26H28N2OS
and a molecular weight of 416.59 g/mol. Its IUPAC name is 3-ethyl-2-(2-phenylsulfanylethyl)spiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one.
Molecular Properties
| Compound Name | 3-ethyl-2-(2-phenylsulfanylethyl)spiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one |
| PubChem CID | 134122164 |
| Molecular Formula | C26H28N2OS |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 3-ethyl-2-(2-phenylsulfanylethyl)spiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one |
| SMILES | CCn1c(CCSc2ccccc2)nc2c(c1=O)C1(CCCC1)Cc1ccccc1-2 |
| InChI | InChI=1S/C26H28N2OS/c1-2-28-22(14-17-30-20-11-4-3-5-12-20)27-24-21-13-7-6-10-19(21)18-26(15-8-9-16-26)23(24)25(28)29/h3-7,10-13H,2,8-9,14-18H2,1H3 |
| InChIKey | RKBORBKVSZZHPE-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-2-(2-phenylsulfanylethyl)spiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-(2-phenylsulfanylethyl)spiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one?
The IUPAC name of 3-ethyl-2-(2-phenylsulfanylethyl)spiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one (CID 134122164) is 3-ethyl-2-(2-phenylsulfanylethyl)spiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one.
What is the SMILES notation for 3-ethyl-2-(2-phenylsulfanylethyl)spiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one?
The canonical SMILES for 3-ethyl-2-(2-phenylsulfanylethyl)spiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one is CCn1c(CCSc2ccccc2)nc2c(c1=O)C1(CCCC1)Cc1ccccc1-2.
What is the InChIKey of 3-ethyl-2-(2-phenylsulfanylethyl)spiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one?
The InChIKey is RKBORBKVSZZHPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28N2OS/c1-2-28-22(14-17-30-20-11-4-3-5-12-20)27-24-21-13-7-6-10-19(21)18-26(15-8-9-16-26)23(24)25(28)29/h3-7,10-13H,2,8-9,14-18H2,1H3.
What are the key properties of 3-ethyl-2-(2-phenylsulfanylethyl)spiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one?
3-ethyl-2-(2-phenylsulfanylethyl)spiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one has a molecular weight of 416.59 g/mol, XLogP of 5.63, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-(2-phenylsulfanylethyl)spiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one is sourced from PubChem (CID 134122164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).