C20H19N3O3 — CID 134122180
ethyl (E)-3-(N-[(E)-benzylideneamino]-4-methoxyanilino)-2-cyanoprop-2-enoate (PubChem CID 134122180) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is ethyl (E)-3-(N-[(E)-benzylideneamino]-4-methoxyanilino)-2-cyanoprop-2-enoate.
| Compound Name | ethyl (E)-3-(N-[(E)-benzylideneamino]-4-methoxyanilino)-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 134122180 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | ethyl (E)-3-(N-[(E)-benzylideneamino]-4-methoxyanilino)-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/N(/N=C/c1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H19N3O3/c1-3-26-20(24)17(13-21)15-23(18-9-11-19(25-2)12-10-18)22-14-16-7-5-4-6-8-16/h4-12,14-15H,3H2,1-2H3/b17-15+,22-14+ |
| InChIKey | DVWSFKOPQIYUKA-ZXZUAFGUSA-N |
| XLogP | 3.51 |
| TPSA | 74.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|