C11H14N2O5S — CID 134122547
[4-[(E)-(ethoxycarbonylhydrazinylidene)methyl]phenyl] methanesulfonate (PubChem CID 134122547) has the molecular formula C11H14N2O5S and a molecular weight of 286.31 g/mol. Its IUPAC name is [4-[(E)-(ethoxycarbonylhydrazinylidene)methyl]phenyl] methanesulfonate.
| Compound Name | [4-[(E)-(ethoxycarbonylhydrazinylidene)methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 134122547 |
| Molecular Formula | C11H14N2O5S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | [4-[(E)-(ethoxycarbonylhydrazinylidene)methyl]phenyl] methanesulfonate |
| SMILES | CCOC(=O)N/N=C/c1ccc(OS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C11H14N2O5S/c1-3-17-11(14)13-12-8-9-4-6-10(7-5-9)18-19(2,15)16/h4-8H,3H2,1-2H3,(H,13,14)/b12-8+ |
| InChIKey | BQHALIZHLITOEE-XYOKQWHBSA-N |
| XLogP | 1.11 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|