C17H14N2O2 — CID 134122589
2-isoquinolin-1-yl-4,5,6,7-tetrahydroisoindole-1,3-dione (PubChem CID 134122589) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-isoquinolin-1-yl-4,5,6,7-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-isoquinolin-1-yl-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 134122589 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-isoquinolin-1-yl-4,5,6,7-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1C2=C(CCCC2)C(=O)N1c1nccc2ccccc12 |
| InChI | InChI=1S/C17H14N2O2/c20-16-13-7-3-4-8-14(13)17(21)19(16)15-12-6-2-1-5-11(12)9-10-18-15/h1-2,5-6,9-10H,3-4,7-8H2 |
| InChIKey | MZMILWLSUPMGBH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|