C13H8F5IN2 — CID 134122734
2-[(3,5-difluoro-4-iodophenyl)methyl]-2-(3,3,3-trifluoropropyl)propanedinitrile (PubChem CID 134122734) has the molecular formula C13H8F5IN2 and a molecular weight of 414.12 g/mol. Its IUPAC name is 2-[(3,5-difluoro-4-iodophenyl)methyl]-2-(3,3,3-trifluoropropyl)propanedinitrile.
| Compound Name | 2-[(3,5-difluoro-4-iodophenyl)methyl]-2-(3,3,3-trifluoropropyl)propanedinitrile |
|---|---|
| PubChem CID | 134122734 |
| Molecular Formula | C13H8F5IN2 |
| Molecular Weight | 414.12 g/mol |
| Exact Mass | 413.97 |
| IUPAC Name | 2-[(3,5-difluoro-4-iodophenyl)methyl]-2-(3,3,3-trifluoropropyl)propanedinitrile |
| SMILES | N#CC(C#N)(CCC(F)(F)F)Cc1cc(F)c(I)c(F)c1 |
| InChI | InChI=1S/C13H8F5IN2/c14-9-3-8(4-10(15)11(9)19)5-12(6-20,7-21)1-2-13(16,17)18/h3-4H,1-2,5H2 |
| InChIKey | IKUZPQHGMJIRNX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.12 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|