About S-propan-2-yl 2-amino-5-chlorobenzenecarbothioate
S-propan-2-yl 2-amino-5-chlorobenzenecarbothioate (PubChem CID 134123075) has the molecular formula C10H12ClNOS
and a molecular weight of 229.73 g/mol. Its IUPAC name is S-propan-2-yl 2-amino-5-chlorobenzenecarbothioate.
Molecular Properties
| Compound Name | S-propan-2-yl 2-amino-5-chlorobenzenecarbothioate |
| PubChem CID | 134123075 |
| Molecular Formula | C10H12ClNOS |
| Molecular Weight | 229.73 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | S-propan-2-yl 2-amino-5-chlorobenzenecarbothioate |
| SMILES | CC(C)SC(=O)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C10H12ClNOS/c1-6(2)14-10(13)8-5-7(11)3-4-9(8)12/h3-6H,12H2,1-2H3 |
| InChIKey | JNLSDTFQADSHNF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.73 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-propan-2-yl 2-amino-5-chlorobenzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-propan-2-yl 2-amino-5-chlorobenzenecarbothioate?
The IUPAC name of S-propan-2-yl 2-amino-5-chlorobenzenecarbothioate (CID 134123075) is S-propan-2-yl 2-amino-5-chlorobenzenecarbothioate.
What is the SMILES notation for S-propan-2-yl 2-amino-5-chlorobenzenecarbothioate?
The canonical SMILES for S-propan-2-yl 2-amino-5-chlorobenzenecarbothioate is CC(C)SC(=O)c1cc(Cl)ccc1N.
What is the InChIKey of S-propan-2-yl 2-amino-5-chlorobenzenecarbothioate?
The InChIKey is JNLSDTFQADSHNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClNOS/c1-6(2)14-10(13)8-5-7(11)3-4-9(8)12/h3-6H,12H2,1-2H3.
What are the key properties of S-propan-2-yl 2-amino-5-chlorobenzenecarbothioate?
S-propan-2-yl 2-amino-5-chlorobenzenecarbothioate has a molecular weight of 229.73 g/mol, XLogP of 3.20, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-propan-2-yl 2-amino-5-chlorobenzenecarbothioate is sourced from PubChem (CID 134123075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).