C19H19NO3 — CID 134123409
2-(2,2-dimethylchromen-8-yl)-4,5,6,7-tetrahydroisoindole-1,3-dione (PubChem CID 134123409) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-(2,2-dimethylchromen-8-yl)-4,5,6,7-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-(2,2-dimethylchromen-8-yl)-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 134123409 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-(2,2-dimethylchromen-8-yl)-4,5,6,7-tetrahydroisoindole-1,3-dione |
| SMILES | CC1(C)C=Cc2cccc(N3C(=O)C4=C(CCCC4)C3=O)c2O1 |
| InChI | InChI=1S/C19H19NO3/c1-19(2)11-10-12-6-5-9-15(16(12)23-19)20-17(21)13-7-3-4-8-14(13)18(20)22/h5-6,9-11H,3-4,7-8H2,1-2H3 |
| InChIKey | YTECKILRDHMYMI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|