C18H19ClN6 — CID 134123554
3-[[2-amino-5-[3-(5-chloro-2-pyridinyl)-3-methylbut-1-ynyl]-6-methylpyrimidin-4-yl]amino]propanenitrile (PubChem CID 134123554) has the molecular formula C18H19ClN6 and a molecular weight of 354.85 g/mol. Its IUPAC name is 3-[[2-amino-5-[3-(5-chloro-2-pyridinyl)-3-methylbut-1-ynyl]-6-methylpyrimidin-4-yl]amino]propanenitrile.
| Compound Name | 3-[[2-amino-5-[3-(5-chloro-2-pyridinyl)-3-methylbut-1-ynyl]-6-methylpyrimidin-4-yl]amino]propanenitrile |
|---|---|
| PubChem CID | 134123554 |
| Molecular Formula | C18H19ClN6 |
| Molecular Weight | 354.85 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 3-[[2-amino-5-[3-(5-chloro-2-pyridinyl)-3-methylbut-1-ynyl]-6-methylpyrimidin-4-yl]amino]propanenitrile |
| SMILES | Cc1nc(N)nc(NCCC#N)c1C#CC(C)(C)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C18H19ClN6/c1-12-14(16(22-10-4-9-20)25-17(21)24-12)7-8-18(2,3)15-6-5-13(19)11-23-15/h5-6,11H,4,10H2,1-3H3,(H3,21,22,24,25) |
| InChIKey | RLYZJOTVSGIJBE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.85 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|