C21H38O2 — CID 134123589
2,2,4,4,10,10,12,12-octamethyl-7,14-dioxadispiro[5.1.58.26]pentadecane (PubChem CID 134123589) has the molecular formula C21H38O2 and a molecular weight of 322.53 g/mol. Its IUPAC name is 2,2,4,4,10,10,12,12-octamethyl-7,14-dioxadispiro[5.1.58.26]pentadecane.
| Compound Name | 2,2,4,4,10,10,12,12-octamethyl-7,14-dioxadispiro[5.1.58.26]pentadecane |
|---|---|
| PubChem CID | 134123589 |
| Molecular Formula | C21H38O2 |
| Molecular Weight | 322.53 g/mol |
| Exact Mass | 322.29 |
| IUPAC Name | 2,2,4,4,10,10,12,12-octamethyl-7,14-dioxadispiro[5.1.58.26]pentadecane |
| SMILES | CC1(C)CC(C)(C)CC2(COC3(CC(C)(C)CC(C)(C)C3)O2)C1 |
| InChI | InChI=1S/C21H38O2/c1-16(2)9-17(3,4)12-20(11-16)15-22-21(23-20)13-18(5,6)10-19(7,8)14-21/h9-15H2,1-8H3 |
| InChIKey | ILELUQZZIIGNGV-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.53 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |