C12H13N5O5S — CID 134123896
N-(3,5-dinitrophenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide (PubChem CID 134123896) has the molecular formula C12H13N5O5S and a molecular weight of 339.33 g/mol. Its IUPAC name is N-(3,5-dinitrophenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide.
| Compound Name | N-(3,5-dinitrophenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide |
|---|---|
| PubChem CID | 134123896 |
| Molecular Formula | C12H13N5O5S |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | N-(3,5-dinitrophenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide |
| SMILES | CC1(C)CN(C(=O)Nc2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)C(=S)N1 |
| InChI | InChI=1S/C12H13N5O5S/c1-12(2)6-15(11(23)14-12)10(18)13-7-3-8(16(19)20)5-9(4-7)17(21)22/h3-5H,6H2,1-2H3,(H,13,18)(H,14,23) |
| InChIKey | PVMUSLLZAGFRKD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|