About N-(3,5-dinitrophenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide
N-(3,5-dinitrophenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide (PubChem CID 134123896) has the molecular formula C12H13N5O5S
and a molecular weight of 339.33 g/mol. Its IUPAC name is N-(3,5-dinitrophenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide.
Molecular Properties
| Compound Name | N-(3,5-dinitrophenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide |
| PubChem CID | 134123896 |
| Molecular Formula | C12H13N5O5S |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | N-(3,5-dinitrophenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide |
| SMILES | CC1(C)CN(C(=O)Nc2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)C(=S)N1 |
| InChI | InChI=1S/C12H13N5O5S/c1-12(2)6-15(11(23)14-12)10(18)13-7-3-8(16(19)20)5-9(4-7)17(21)22/h3-5H,6H2,1-2H3,(H,13,18)(H,14,23) |
| InChIKey | PVMUSLLZAGFRKD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(3,5-dinitrophenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dinitrophenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide?
The IUPAC name of N-(3,5-dinitrophenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide (CID 134123896) is N-(3,5-dinitrophenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide.
What is the SMILES notation for N-(3,5-dinitrophenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide?
The canonical SMILES for N-(3,5-dinitrophenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide is CC1(C)CN(C(=O)Nc2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)C(=S)N1.
What is the InChIKey of N-(3,5-dinitrophenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide?
The InChIKey is PVMUSLLZAGFRKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N5O5S/c1-12(2)6-15(11(23)14-12)10(18)13-7-3-8(16(19)20)5-9(4-7)17(21)22/h3-5H,6H2,1-2H3,(H,13,18)(H,14,23).
What are the key properties of N-(3,5-dinitrophenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide?
N-(3,5-dinitrophenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide has a molecular weight of 339.33 g/mol, XLogP of 2.00, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dinitrophenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide is sourced from PubChem (CID 134123896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).