About 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-nitro-3H-pyridin-2-one
3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-nitro-3H-pyridin-2-one (PubChem CID 134124134) has the molecular formula C14H8F6N2O3
and a molecular weight of 366.22 g/mol. Its IUPAC name is 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-nitro-3H-pyridin-2-one.
Molecular Properties
| Compound Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-nitro-3H-pyridin-2-one |
| PubChem CID | 134124134 |
| Molecular Formula | C14H8F6N2O3 |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-nitro-3H-pyridin-2-one |
| SMILES | O=C1N=CC([N+](=O)[O-])=CC1Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H8F6N2O3/c15-13(16,17)9-2-7(3-10(5-9)14(18,19)20)1-8-4-11(22(24)25)6-21-12(8)23/h2-6,8H,1H2 |
| InChIKey | VDVBUASHXSGLPQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 72.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-nitro-3H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-nitro-3H-pyridin-2-one?
The IUPAC name of 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-nitro-3H-pyridin-2-one (CID 134124134) is 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-nitro-3H-pyridin-2-one.
What is the SMILES notation for 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-nitro-3H-pyridin-2-one?
The canonical SMILES for 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-nitro-3H-pyridin-2-one is O=C1N=CC([N+](=O)[O-])=CC1Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-nitro-3H-pyridin-2-one?
The InChIKey is VDVBUASHXSGLPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8F6N2O3/c15-13(16,17)9-2-7(3-10(5-9)14(18,19)20)1-8-4-11(22(24)25)6-21-12(8)23/h2-6,8H,1H2.
What are the key properties of 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-nitro-3H-pyridin-2-one?
3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-nitro-3H-pyridin-2-one has a molecular weight of 366.22 g/mol, XLogP of 3.65, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-nitro-3H-pyridin-2-one is sourced from PubChem (CID 134124134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).