About 6a-(2-chlorophenyl)-6H-isoindolo[2,1-a]quinazoline-5,11-dione
6a-(2-chlorophenyl)-6H-isoindolo[2,1-a]quinazoline-5,11-dione (PubChem CID 134124391) has the molecular formula C21H13ClN2O2
and a molecular weight of 360.80 g/mol. Its IUPAC name is 6a-(2-chlorophenyl)-6H-isoindolo[2,1-a]quinazoline-5,11-dione.
Molecular Properties
| Compound Name | 6a-(2-chlorophenyl)-6H-isoindolo[2,1-a]quinazoline-5,11-dione |
| PubChem CID | 134124391 |
| Molecular Formula | C21H13ClN2O2 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 6a-(2-chlorophenyl)-6H-isoindolo[2,1-a]quinazoline-5,11-dione |
| SMILES | O=C1NC2(c3ccccc3Cl)c3ccccc3C(=O)N2c2ccccc21 |
| InChI | InChI=1S/C21H13ClN2O2/c22-17-11-5-4-10-16(17)21-15-9-3-1-7-13(15)20(26)24(21)18-12-6-2-8-14(18)19(25)23-21/h1-12H,(H,23,25) |
| InChIKey | SZDXTZMXFFCXCA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6a-(2-chlorophenyl)-6H-isoindolo[2,1-a]quinazoline-5,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6a-(2-chlorophenyl)-6H-isoindolo[2,1-a]quinazoline-5,11-dione?
The IUPAC name of 6a-(2-chlorophenyl)-6H-isoindolo[2,1-a]quinazoline-5,11-dione (CID 134124391) is 6a-(2-chlorophenyl)-6H-isoindolo[2,1-a]quinazoline-5,11-dione.
What is the SMILES notation for 6a-(2-chlorophenyl)-6H-isoindolo[2,1-a]quinazoline-5,11-dione?
The canonical SMILES for 6a-(2-chlorophenyl)-6H-isoindolo[2,1-a]quinazoline-5,11-dione is O=C1NC2(c3ccccc3Cl)c3ccccc3C(=O)N2c2ccccc21.
What is the InChIKey of 6a-(2-chlorophenyl)-6H-isoindolo[2,1-a]quinazoline-5,11-dione?
The InChIKey is SZDXTZMXFFCXCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13ClN2O2/c22-17-11-5-4-10-16(17)21-15-9-3-1-7-13(15)20(26)24(21)18-12-6-2-8-14(18)19(25)23-21/h1-12H,(H,23,25).
What are the key properties of 6a-(2-chlorophenyl)-6H-isoindolo[2,1-a]quinazoline-5,11-dione?
6a-(2-chlorophenyl)-6H-isoindolo[2,1-a]quinazoline-5,11-dione has a molecular weight of 360.80 g/mol, XLogP of 3.94, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6a-(2-chlorophenyl)-6H-isoindolo[2,1-a]quinazoline-5,11-dione is sourced from PubChem (CID 134124391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).